C12H14Cl2INO3 — CID 107866638
3,5-dichloro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-iodobenzamide (PubChem CID 107866638) has the molecular formula C12H14Cl2INO3 and a molecular weight of 418.06 g/mol. Its IUPAC name is 3,5-dichloro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-iodobenzamide.
| Compound Name | 3,5-dichloro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-iodobenzamide |
|---|---|
| PubChem CID | 107866638 |
| Molecular Formula | C12H14Cl2INO3 |
| Molecular Weight | 418.06 g/mol |
| Exact Mass | 416.94 |
| IUPAC Name | 3,5-dichloro-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-2-iodobenzamide |
| SMILES | CCC(CO)(CO)NC(=O)c1cc(Cl)cc(Cl)c1I |
| InChI | InChI=1S/C12H14Cl2INO3/c1-2-12(5-17,6-18)16-11(19)8-3-7(13)4-9(14)10(8)15/h3-4,17-18H,2,5-6H2,1H3,(H,16,19) |
| InChIKey | NIQGDDWLWUJYPL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.06 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|