C14H18Cl2INO2 — CID 103843634
3,5-dichloro-N-[2-ethyl-2-(hydroxymethyl)butyl]-2-iodobenzamide (PubChem CID 103843634) has the molecular formula C14H18Cl2INO2 and a molecular weight of 430.11 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-ethyl-2-(hydroxymethyl)butyl]-2-iodobenzamide.
| Compound Name | 3,5-dichloro-N-[2-ethyl-2-(hydroxymethyl)butyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 103843634 |
| Molecular Formula | C14H18Cl2INO2 |
| Molecular Weight | 430.11 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | 3,5-dichloro-N-[2-ethyl-2-(hydroxymethyl)butyl]-2-iodobenzamide |
| SMILES | CCC(CC)(CO)CNC(=O)c1cc(Cl)cc(Cl)c1I |
| InChI | InChI=1S/C14H18Cl2INO2/c1-3-14(4-2,8-19)7-18-13(20)10-5-9(15)6-11(16)12(10)17/h5-6,19H,3-4,7-8H2,1-2H3,(H,18,20) |
| InChIKey | BMQDOCBGNRPPMR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.11 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|