C12H12Cl2INO3 — CID 79792974
2-[(3,5-dichloro-2-iodobenzoyl)amino]-2-methylbutanoic acid (PubChem CID 79792974) has the molecular formula C12H12Cl2INO3 and a molecular weight of 416.04 g/mol. Its IUPAC name is 2-[(3,5-dichloro-2-iodobenzoyl)amino]-2-methylbutanoic acid.
| Compound Name | 2-[(3,5-dichloro-2-iodobenzoyl)amino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 79792974 |
| Molecular Formula | C12H12Cl2INO3 |
| Molecular Weight | 416.04 g/mol |
| Exact Mass | 414.92 |
| IUPAC Name | 2-[(3,5-dichloro-2-iodobenzoyl)amino]-2-methylbutanoic acid |
| SMILES | CCC(C)(NC(=O)c1cc(Cl)cc(Cl)c1I)C(=O)O |
| InChI | InChI=1S/C12H12Cl2INO3/c1-3-12(2,11(18)19)16-10(17)7-4-6(13)5-8(14)9(7)15/h4-5H,3H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | DQTRWTLCOOWNHO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.04 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|