C11H10Cl2INO4 — CID 66172799
3-[(3,5-dichloro-2-iodobenzoyl)amino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 66172799) has the molecular formula C11H10Cl2INO4 and a molecular weight of 418.01 g/mol. Its IUPAC name is 3-[(3,5-dichloro-2-iodobenzoyl)amino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[(3,5-dichloro-2-iodobenzoyl)amino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 66172799 |
| Molecular Formula | C11H10Cl2INO4 |
| Molecular Weight | 418.01 g/mol |
| Exact Mass | 416.90 |
| IUPAC Name | 3-[(3,5-dichloro-2-iodobenzoyl)amino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CC(O)(CNC(=O)c1cc(Cl)cc(Cl)c1I)C(=O)O |
| InChI | InChI=1S/C11H10Cl2INO4/c1-11(19,10(17)18)4-15-9(16)6-2-5(12)3-7(13)8(6)14/h2-3,19H,4H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | LOHTTZZQPBALKE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.01 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|