C10H10Cl3NO3 — CID 104643883
2-hydroxy-2-methyl-3-(2,4,6-trichloroanilino)propanoic acid (PubChem CID 104643883) has the molecular formula C10H10Cl3NO3 and a molecular weight of 298.55 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-3-(2,4,6-trichloroanilino)propanoic acid.
| Compound Name | 2-hydroxy-2-methyl-3-(2,4,6-trichloroanilino)propanoic acid |
|---|---|
| PubChem CID | 104643883 |
| Molecular Formula | C10H10Cl3NO3 |
| Molecular Weight | 298.55 g/mol |
| Exact Mass | 296.97 |
| IUPAC Name | 2-hydroxy-2-methyl-3-(2,4,6-trichloroanilino)propanoic acid |
| SMILES | CC(O)(CNc1c(Cl)cc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C10H10Cl3NO3/c1-10(17,9(15)16)4-14-8-6(12)2-5(11)3-7(8)13/h2-3,14,17H,4H2,1H3,(H,15,16) |
| InChIKey | UQXNOSFNGCYMHX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |