C12H14Cl3NO2 — CID 79623311
methyl 2,2-dimethyl-3-(2,4,6-trichloroanilino)propanoate (PubChem CID 79623311) has the molecular formula C12H14Cl3NO2 and a molecular weight of 310.61 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-(2,4,6-trichloroanilino)propanoate.
| Compound Name | methyl 2,2-dimethyl-3-(2,4,6-trichloroanilino)propanoate |
|---|---|
| PubChem CID | 79623311 |
| Molecular Formula | C12H14Cl3NO2 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | methyl 2,2-dimethyl-3-(2,4,6-trichloroanilino)propanoate |
| SMILES | COC(=O)C(C)(C)CNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl3NO2/c1-12(2,11(17)18-3)6-16-10-8(14)4-7(13)5-9(10)15/h4-5,16H,6H2,1-3H3 |
| InChIKey | IDSAXCDURNQBCL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |