C12H15BrClNO2 — CID 79624436
methyl 3-(4-bromo-2-chloroanilino)-2,2-dimethylpropanoate (PubChem CID 79624436) has the molecular formula C12H15BrClNO2 and a molecular weight of 320.61 g/mol. Its IUPAC name is methyl 3-(4-bromo-2-chloroanilino)-2,2-dimethylpropanoate.
| Compound Name | methyl 3-(4-bromo-2-chloroanilino)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 79624436 |
| Molecular Formula | C12H15BrClNO2 |
| Molecular Weight | 320.61 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | methyl 3-(4-bromo-2-chloroanilino)-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)CNc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C12H15BrClNO2/c1-12(2,11(16)17-3)7-15-10-5-4-8(13)6-9(10)14/h4-6,15H,7H2,1-3H3 |
| InChIKey | TYCWSCZJXVJSOG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.61 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |