C12H15BrClNOS — CID 78780727
N-(4-bromo-2-chlorophenyl)-2-tert-butylsulfanylacetamide (PubChem CID 78780727) has the molecular formula C12H15BrClNOS and a molecular weight of 336.68 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-2-tert-butylsulfanylacetamide.
| Compound Name | N-(4-bromo-2-chlorophenyl)-2-tert-butylsulfanylacetamide |
|---|---|
| PubChem CID | 78780727 |
| Molecular Formula | C12H15BrClNOS |
| Molecular Weight | 336.68 g/mol |
| Exact Mass | 334.97 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-2-tert-butylsulfanylacetamide |
| SMILES | CC(C)(C)SCC(=O)Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C12H15BrClNOS/c1-12(2,3)17-7-11(16)15-10-5-4-8(13)6-9(10)14/h4-6H,7H2,1-3H3,(H,15,16) |
| InChIKey | SXCIDUGNLSWYEO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.68 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |