C14H11BrClNO2S — CID 47263024
N-(4-bromo-2-chlorophenyl)-2-(4-hydroxyphenyl)sulfanylacetamide (PubChem CID 47263024) has the molecular formula C14H11BrClNO2S and a molecular weight of 372.67 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-2-(4-hydroxyphenyl)sulfanylacetamide.
| Compound Name | N-(4-bromo-2-chlorophenyl)-2-(4-hydroxyphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 47263024 |
| Molecular Formula | C14H11BrClNO2S |
| Molecular Weight | 372.67 g/mol |
| Exact Mass | 370.94 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-2-(4-hydroxyphenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc(O)cc1)Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C14H11BrClNO2S/c15-9-1-6-13(12(16)7-9)17-14(19)8-20-11-4-2-10(18)3-5-11/h1-7,18H,8H2,(H,17,19) |
| InChIKey | RYVKBZBUJMMBME-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.67 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |