C15H11BrClN5O2S — CID 24571050
N-(4-bromo-2-chlorophenyl)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 24571050) has the molecular formula C15H11BrClN5O2S and a molecular weight of 440.71 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(4-bromo-2-chlorophenyl)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 24571050 |
| Molecular Formula | C15H11BrClN5O2S |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 438.95 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1ccc(O)cc1)Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H11BrClN5O2S/c16-9-1-6-13(12(17)7-9)18-14(24)8-25-15-19-20-21-22(15)10-2-4-11(23)5-3-10/h1-7,23H,8H2,(H,18,24) |
| InChIKey | PLYXMTCOZSWAHX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |