C15H12ClN5O2S — CID 4814769
N-(4-chlorophenyl)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 4814769) has the molecular formula C15H12ClN5O2S and a molecular weight of 361.81 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(4-chlorophenyl)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4814769 |
| Molecular Formula | C15H12ClN5O2S |
| Molecular Weight | 361.81 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | N-(4-chlorophenyl)-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1ccc(O)cc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H12ClN5O2S/c16-10-1-3-11(4-2-10)17-14(23)9-24-15-18-19-20-21(15)12-5-7-13(22)8-6-12/h1-8,22H,9H2,(H,17,23) |
| InChIKey | PLTLJZUFRJEVLD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.81 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |