C19H19ClN6OS — CID 4265931
2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 4265931) has the molecular formula C19H19ClN6OS and a molecular weight of 414.92 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 4265931 |
| Molecular Formula | C19H19ClN6OS |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | O=C(CSc1nnnn1-c1ccc(Cl)cc1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C19H19ClN6OS/c20-14-3-7-17(8-4-14)26-19(22-23-24-26)28-13-18(27)21-15-5-9-16(10-6-15)25-11-1-2-12-25/h3-10H,1-2,11-13H2,(H,21,27) |
| InChIKey | IQWTXTNXFHIDCV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|