C14H16ClN5OS — CID 817369
2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-1-piperidin-1-ylethanone (PubChem CID 817369) has the molecular formula C14H16ClN5OS and a molecular weight of 337.84 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-1-piperidin-1-ylethanone.
| Compound Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 817369 |
| Molecular Formula | C14H16ClN5OS |
| Molecular Weight | 337.84 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanyl-1-piperidin-1-ylethanone |
| SMILES | O=C(CSc1nnnn1-c1ccc(Cl)cc1)N1CCCCC1 |
| InChI | InChI=1S/C14H16ClN5OS/c15-11-4-6-12(7-5-11)20-14(16-17-18-20)22-10-13(21)19-8-2-1-3-9-19/h4-7H,1-3,8-10H2 |
| InChIKey | DYHFOYIWORDCQU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.84 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |