C15H18ClN5OS — CID 3996030
1-(azepan-1-yl)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylethanone (PubChem CID 3996030) has the molecular formula C15H18ClN5OS and a molecular weight of 351.86 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylethanone.
| Compound Name | 1-(azepan-1-yl)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylethanone |
|---|---|
| PubChem CID | 3996030 |
| Molecular Formula | C15H18ClN5OS |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 1-(azepan-1-yl)-2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylethanone |
| SMILES | O=C(CSc1nnnn1-c1ccc(Cl)cc1)N1CCCCCC1 |
| InChI | InChI=1S/C15H18ClN5OS/c16-12-5-7-13(8-6-12)21-15(17-18-19-21)23-11-14(22)20-9-3-1-2-4-10-20/h5-8H,1-4,9-11H2 |
| InChIKey | XRPWVDCOMCVOBD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |