C15H19N5O2S — CID 7474218
2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-1-(4-methylpiperidin-1-yl)ethanone (PubChem CID 7474218) has the molecular formula C15H19N5O2S and a molecular weight of 333.42 g/mol. Its IUPAC name is 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-1-(4-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-1-(4-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 7474218 |
| Molecular Formula | C15H19N5O2S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-1-(4-methylpiperidin-1-yl)ethanone |
| SMILES | CC1CCN(C(=O)CSc2nnnn2-c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C15H19N5O2S/c1-11-6-8-19(9-7-11)14(22)10-23-15-16-17-18-20(15)12-2-4-13(21)5-3-12/h2-5,11,21H,6-10H2,1H3 |
| InChIKey | PGRLZNABUWDIKH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |