C17H21N5O3S — CID 9407681
methyl 1-[2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetyl]piperidine-4-carboxylate (PubChem CID 9407681) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is methyl 1-[2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 9407681 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | methyl 1-[2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)CSc2nnnn2-c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C17H21N5O3S/c1-12-3-5-14(6-4-12)22-17(18-19-20-22)26-11-15(23)21-9-7-13(8-10-21)16(24)25-2/h3-6,13H,7-11H2,1-2H3 |
| InChIKey | RQQYKHRINJNYEH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |