C22H25N5OS — CID 2616037
1-(4-benzylpiperidin-1-yl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylethanone (PubChem CID 2616037) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylethanone.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylethanone |
|---|---|
| PubChem CID | 2616037 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylethanone |
| SMILES | Cc1ccc(-n2nnnc2SCC(=O)N2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H25N5OS/c1-17-7-9-20(10-8-17)27-22(23-24-25-27)29-16-21(28)26-13-11-19(12-14-26)15-18-5-3-2-4-6-18/h2-10,19H,11-16H2,1H3 |
| InChIKey | VMUGWKLBUIHXEC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |