C15H17N5O4S — CID 1037954
methyl 4-[5-(2-morpholin-4-yl-2-oxoethyl)sulfanyltetrazol-1-yl]benzoate (PubChem CID 1037954) has the molecular formula C15H17N5O4S and a molecular weight of 363.40 g/mol. Its IUPAC name is methyl 4-[5-(2-morpholin-4-yl-2-oxoethyl)sulfanyltetrazol-1-yl]benzoate.
| Compound Name | methyl 4-[5-(2-morpholin-4-yl-2-oxoethyl)sulfanyltetrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 1037954 |
| Molecular Formula | C15H17N5O4S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | methyl 4-[5-(2-morpholin-4-yl-2-oxoethyl)sulfanyltetrazol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2nnnc2SCC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C15H17N5O4S/c1-23-14(22)11-2-4-12(5-3-11)20-15(16-17-18-20)25-10-13(21)19-6-8-24-9-7-19/h2-5H,6-10H2,1H3 |
| InChIKey | MWNZATNDKJZJGW-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 99.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |