C17H13FN4O3S — CID 1175830
methyl 4-[5-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoate (PubChem CID 1175830) has the molecular formula C17H13FN4O3S and a molecular weight of 372.38 g/mol. Its IUPAC name is methyl 4-[5-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoate.
| Compound Name | methyl 4-[5-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 1175830 |
| Molecular Formula | C17H13FN4O3S |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | methyl 4-[5-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2nnnc2SCC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H13FN4O3S/c1-25-16(24)12-4-8-14(9-5-12)22-17(19-20-21-22)26-10-15(23)11-2-6-13(18)7-3-11/h2-9H,10H2,1H3 |
| InChIKey | MIQWNHZXRRXUBV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |