C11H11N5O3S — CID 726072
methyl 2-[1-(4-carbamoylphenyl)tetrazol-5-yl]sulfanylacetate (PubChem CID 726072) has the molecular formula C11H11N5O3S and a molecular weight of 293.31 g/mol. Its IUPAC name is methyl 2-[1-(4-carbamoylphenyl)tetrazol-5-yl]sulfanylacetate.
| Compound Name | methyl 2-[1-(4-carbamoylphenyl)tetrazol-5-yl]sulfanylacetate |
|---|---|
| PubChem CID | 726072 |
| Molecular Formula | C11H11N5O3S |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | methyl 2-[1-(4-carbamoylphenyl)tetrazol-5-yl]sulfanylacetate |
| SMILES | COC(=O)CSc1nnnn1-c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C11H11N5O3S/c1-19-9(17)6-20-11-13-14-15-16(11)8-4-2-7(3-5-8)10(12)18/h2-5H,6H2,1H3,(H2,12,18) |
| InChIKey | FKMYGZGTDHZRGQ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |