C12H13ClN4O2S — CID 47095765
propan-2-yl 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetate (PubChem CID 47095765) has the molecular formula C12H13ClN4O2S and a molecular weight of 312.78 g/mol. Its IUPAC name is propan-2-yl 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetate.
| Compound Name | propan-2-yl 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetate |
|---|---|
| PubChem CID | 47095765 |
| Molecular Formula | C12H13ClN4O2S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | propan-2-yl 2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetate |
| SMILES | CC(C)OC(=O)CSc1nnnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClN4O2S/c1-8(2)19-11(18)7-20-12-14-15-16-17(12)10-5-3-9(13)4-6-10/h3-6,8H,7H2,1-2H3 |
| InChIKey | BASDGEMFJZINKG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |