C16H20N6O2S — CID 1071313
4-[5-[2-(cyclohexylamino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzamide (PubChem CID 1071313) has the molecular formula C16H20N6O2S and a molecular weight of 360.44 g/mol. Its IUPAC name is 4-[5-[2-(cyclohexylamino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzamide.
| Compound Name | 4-[5-[2-(cyclohexylamino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzamide |
|---|---|
| PubChem CID | 1071313 |
| Molecular Formula | C16H20N6O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 4-[5-[2-(cyclohexylamino)-2-oxoethyl]sulfanyltetrazol-1-yl]benzamide |
| SMILES | NC(=O)c1ccc(-n2nnnc2SCC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C16H20N6O2S/c17-15(24)11-6-8-13(9-7-11)22-16(19-20-21-22)25-10-14(23)18-12-4-2-1-3-5-12/h6-9,12H,1-5,10H2,(H2,17,24)(H,18,23) |
| InChIKey | AAPHXFMVHKGVGC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |