C15H18FN5OS — CID 1449761
N-cyclohexyl-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 1449761) has the molecular formula C15H18FN5OS and a molecular weight of 335.41 g/mol. Its IUPAC name is N-cyclohexyl-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-cyclohexyl-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 1449761 |
| Molecular Formula | C15H18FN5OS |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N-cyclohexyl-2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1cccc(F)c1)NC1CCCCC1 |
| InChI | InChI=1S/C15H18FN5OS/c16-11-5-4-8-13(9-11)21-15(18-19-20-21)23-10-14(22)17-12-6-2-1-3-7-12/h4-5,8-9,12H,1-3,6-7,10H2,(H,17,22) |
| InChIKey | ROGSEKRASFUAAC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |