C21H22N6O2S — CID 2621097
N-cyclopentyl-2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]benzamide (PubChem CID 2621097) has the molecular formula C21H22N6O2S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-cyclopentyl-2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]benzamide.
| Compound Name | N-cyclopentyl-2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 2621097 |
| Molecular Formula | C21H22N6O2S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | N-cyclopentyl-2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]benzamide |
| SMILES | O=C(CSc1nnnn1-c1ccccc1)Nc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C21H22N6O2S/c28-19(14-30-21-24-25-26-27(21)16-10-2-1-3-11-16)23-18-13-7-6-12-17(18)20(29)22-15-8-4-5-9-15/h1-3,6-7,10-13,15H,4-5,8-9,14H2,(H,22,29)(H,23,28) |
| InChIKey | XDIRVCZXZLCGEI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |