C14H12N6OS — CID 578136
2-(1-phenyltetrazol-5-yl)sulfanyl-N-pyridin-2-ylacetamide (PubChem CID 578136) has the molecular formula C14H12N6OS and a molecular weight of 312.36 g/mol. Its IUPAC name is 2-(1-phenyltetrazol-5-yl)sulfanyl-N-pyridin-2-ylacetamide.
| Compound Name | 2-(1-phenyltetrazol-5-yl)sulfanyl-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 578136 |
| Molecular Formula | C14H12N6OS |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-(1-phenyltetrazol-5-yl)sulfanyl-N-pyridin-2-ylacetamide |
| SMILES | O=C(CSc1nnnn1-c1ccccc1)Nc1ccccn1 |
| InChI | InChI=1S/C14H12N6OS/c21-13(16-12-8-4-5-9-15-12)10-22-14-17-18-19-20(14)11-6-2-1-3-7-11/h1-9H,10H2,(H,15,16,21) |
| InChIKey | BGLSDVVHSXPOQW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |