C16H12KN5O3S — CID 44889777
potassium 2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]benzoate (PubChem CID 44889777) has the molecular formula C16H12KN5O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is potassium 2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]benzoate.
| Compound Name | potassium 2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 44889777 |
| Molecular Formula | C16H12KN5O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | potassium 2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]benzoate |
| SMILES | O=C(CSc1nnnn1-c1ccccc1)Nc1ccccc1C(=O)[O-].[K+] |
| InChI | InChI=1S/C16H13N5O3S.K/c22-14(17-13-9-5-4-8-12(13)15(23)24)10-25-16-18-19-20-21(16)11-6-2-1-3-7-11;/h1-9H,10H2,(H,17,22)(H,23,24);/q;+1/p-1 |
| InChIKey | WZPVJKIKXIHOBS-UHFFFAOYSA-M |
| XLogP | -2.24 |
| TPSA | 112.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |