C18H17N5O3S — CID 18874200
2-[[2-[1-(4-ethylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoic acid (PubChem CID 18874200) has the molecular formula C18H17N5O3S and a molecular weight of 383.43 g/mol. Its IUPAC name is 2-[[2-[1-(4-ethylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[1-(4-ethylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 18874200 |
| Molecular Formula | C18H17N5O3S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-[[2-[1-(4-ethylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzoic acid |
| SMILES | CCc1ccc(-n2nnnc2SCC(=O)Nc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C18H17N5O3S/c1-2-12-7-9-13(10-8-12)23-18(20-21-22-23)27-11-16(24)19-15-6-4-3-5-14(15)17(25)26/h3-10H,2,11H2,1H3,(H,19,24)(H,25,26) |
| InChIKey | PJKHJFKYSLDXDC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |