C19H21N5O2S — CID 8793054
N-[(1R)-1-(4-ethylphenyl)ethyl]-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 8793054) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is N-[(1R)-1-(4-ethylphenyl)ethyl]-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[(1R)-1-(4-ethylphenyl)ethyl]-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 8793054 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N-[(1R)-1-(4-ethylphenyl)ethyl]-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | CCc1ccc([C@@H](C)NC(=O)CSc2nnnn2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C19H21N5O2S/c1-3-14-4-6-15(7-5-14)13(2)20-18(26)12-27-19-21-22-23-24(19)16-8-10-17(25)11-9-16/h4-11,13,25H,3,12H2,1-2H3,(H,20,26)/t13-/m1/s1 |
| InChIKey | DPMCSZXOWKRMTQ-CYBMUJFWSA-N |
| XLogP | 2.90 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |