C17H25N5O2S — CID 9073912
2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-[(2R)-6-methylheptan-2-yl]acetamide (PubChem CID 9073912) has the molecular formula C17H25N5O2S and a molecular weight of 363.49 g/mol. Its IUPAC name is 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-[(2R)-6-methylheptan-2-yl]acetamide.
| Compound Name | 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-[(2R)-6-methylheptan-2-yl]acetamide |
|---|---|
| PubChem CID | 9073912 |
| Molecular Formula | C17H25N5O2S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-[(2R)-6-methylheptan-2-yl]acetamide |
| SMILES | CC(C)CCC[C@@H](C)NC(=O)CSc1nnnn1-c1ccc(O)cc1 |
| InChI | InChI=1S/C17H25N5O2S/c1-12(2)5-4-6-13(3)18-16(24)11-25-17-19-20-21-22(17)14-7-9-15(23)10-8-14/h7-10,12-13,23H,4-6,11H2,1-3H3,(H,18,24)/t13-/m1/s1 |
| InChIKey | JDOIQNBGZKEORY-CYBMUJFWSA-N |
| XLogP | 2.79 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |