C17H25N5OS — CID 8684772
N-[(2S)-5-methylhexan-2-yl]-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 8684772) has the molecular formula C17H25N5OS and a molecular weight of 347.49 g/mol. Its IUPAC name is N-[(2S)-5-methylhexan-2-yl]-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[(2S)-5-methylhexan-2-yl]-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 8684772 |
| Molecular Formula | C17H25N5OS |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-[(2S)-5-methylhexan-2-yl]-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | Cc1ccc(-n2nnnc2SCC(=O)N[C@@H](C)CCC(C)C)cc1 |
| InChI | InChI=1S/C17H25N5OS/c1-12(2)5-8-14(4)18-16(23)11-24-17-19-20-21-22(17)15-9-6-13(3)7-10-15/h6-7,9-10,12,14H,5,8,11H2,1-4H3,(H,18,23)/t14-/m0/s1 |
| InChIKey | RRFGFXSIVBEIRC-AWEZNQCLSA-N |
| XLogP | 3.00 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |