C15H21N5O2S — CID 2696351
2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-[(2R)-pentan-2-yl]acetamide (PubChem CID 2696351) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-[(2R)-pentan-2-yl]acetamide.
| Compound Name | 2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-[(2R)-pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 2696351 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-N-[(2R)-pentan-2-yl]acetamide |
| SMILES | CCC[C@@H](C)NC(=O)CSc1nnnn1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C15H21N5O2S/c1-4-5-11(2)16-14(21)10-23-15-17-18-19-20(15)12-6-8-13(22-3)9-7-12/h6-9,11H,4-5,10H2,1-3H3,(H,16,21)/t11-/m1/s1 |
| InChIKey | FLRFWECIRITJFX-LLVKDONJSA-N |
| XLogP | 2.07 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |