C16H15N5O3S — CID 4814756
2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-(4-methoxyphenyl)acetamide (PubChem CID 4814756) has the molecular formula C16H15N5O3S and a molecular weight of 357.40 g/mol. Its IUPAC name is 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4814756 |
| Molecular Formula | C16H15N5O3S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanyl-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nnnn2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C16H15N5O3S/c1-24-14-8-2-11(3-9-14)17-15(23)10-25-16-18-19-20-21(16)12-4-6-13(22)7-5-12/h2-9,22H,10H2,1H3,(H,17,23) |
| InChIKey | HANIUJLAKCONBU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |