C26H33N7O2S — CID 4993355
N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 4993355) has the molecular formula C26H33N7O2S and a molecular weight of 507.66 g/mol. Its IUPAC name is N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4993355 |
| Molecular Formula | C26H33N7O2S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | COc1ccc(-n2nnnc2SCC(=O)Nc2ccc(N3CCN(C4CCCCC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H33N7O2S/c1-35-24-13-11-23(12-14-24)33-26(28-29-30-33)36-19-25(34)27-20-7-9-22(10-8-20)32-17-15-31(16-18-32)21-5-3-2-4-6-21/h7-14,21H,2-6,15-19H2,1H3,(H,27,34) |
| InChIKey | ZXOFDRLKPORJEL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|