C18H20N6O4S2 — CID 3340473
N-[4-(dimethylsulfamoyl)phenyl]-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 3340473) has the molecular formula C18H20N6O4S2 and a molecular weight of 448.53 g/mol. Its IUPAC name is N-[4-(dimethylsulfamoyl)phenyl]-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[4-(dimethylsulfamoyl)phenyl]-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 3340473 |
| Molecular Formula | C18H20N6O4S2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N-[4-(dimethylsulfamoyl)phenyl]-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | COc1ccc(-n2nnnc2SCC(=O)Nc2ccc(S(=O)(=O)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C18H20N6O4S2/c1-23(2)30(26,27)16-10-4-13(5-11-16)19-17(25)12-29-18-20-21-22-24(18)14-6-8-15(28-3)9-7-14/h4-11H,12H2,1-3H3,(H,19,25) |
| InChIKey | DPSXESUMNXOJNV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |