C19H22N6O4S2 — CID 2109822
N-[4-(diethylsulfamoyl)phenyl]-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 2109822) has the molecular formula C19H22N6O4S2 and a molecular weight of 462.56 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 2109822 |
| Molecular Formula | C19H22N6O4S2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-2-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)CSc2nnnn2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C19H22N6O4S2/c1-3-24(4-2)31(28,29)17-11-5-14(6-12-17)20-18(27)13-30-19-21-22-23-25(19)15-7-9-16(26)10-8-15/h5-12,26H,3-4,13H2,1-2H3,(H,20,27) |
| InChIKey | YEBQLTZMIZEOFW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |