C21H26N6OS — CID 2615999
N-[4-[ethyl(propan-2-yl)amino]phenyl]-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 2615999) has the molecular formula C21H26N6OS and a molecular weight of 410.55 g/mol. Its IUPAC name is N-[4-[ethyl(propan-2-yl)amino]phenyl]-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[4-[ethyl(propan-2-yl)amino]phenyl]-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 2615999 |
| Molecular Formula | C21H26N6OS |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | N-[4-[ethyl(propan-2-yl)amino]phenyl]-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | CCN(c1ccc(NC(=O)CSc2nnnn2-c2ccc(C)cc2)cc1)C(C)C |
| InChI | InChI=1S/C21H26N6OS/c1-5-26(15(2)3)18-12-8-17(9-13-18)22-20(28)14-29-21-23-24-25-27(21)19-10-6-16(4)7-11-19/h6-13,15H,5,14H2,1-4H3,(H,22,28) |
| InChIKey | YWYVVSDEUZXQFL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |