C23H27N7O2S — CID 4305589
2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanyl-N-[4-(4-propanoylpiperazin-1-yl)phenyl]acetamide (PubChem CID 4305589) has the molecular formula C23H27N7O2S and a molecular weight of 465.58 g/mol. Its IUPAC name is 2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanyl-N-[4-(4-propanoylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanyl-N-[4-(4-propanoylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 4305589 |
| Molecular Formula | C23H27N7O2S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanyl-N-[4-(4-propanoylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CCC(=O)N1CCN(c2ccc(NC(=O)CSc3nnnn3-c3ccc(C)cc3)cc2)CC1 |
| InChI | InChI=1S/C23H27N7O2S/c1-3-22(32)29-14-12-28(13-15-29)19-10-6-18(7-11-19)24-21(31)16-33-23-25-26-27-30(23)20-8-4-17(2)5-9-20/h4-11H,3,12-16H2,1-2H3,(H,24,31) |
| InChIKey | PHCWFDHBCQXLCP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|