C27H26BrN7O2S — CID 4212380
N-[4-[4-(4-bromobenzoyl)piperazin-1-yl]phenyl]-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 4212380) has the molecular formula C27H26BrN7O2S and a molecular weight of 592.52 g/mol. Its IUPAC name is N-[4-[4-(4-bromobenzoyl)piperazin-1-yl]phenyl]-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[4-[4-(4-bromobenzoyl)piperazin-1-yl]phenyl]-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4212380 |
| Molecular Formula | C27H26BrN7O2S |
| Molecular Weight | 592.52 g/mol |
| Exact Mass | 591.11 |
| IUPAC Name | N-[4-[4-(4-bromobenzoyl)piperazin-1-yl]phenyl]-2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | Cc1ccc(-n2nnnc2SCC(=O)Nc2ccc(N3CCN(C(=O)c4ccc(Br)cc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H26BrN7O2S/c1-19-2-10-24(11-3-19)35-27(30-31-32-35)38-18-25(36)29-22-8-12-23(13-9-22)33-14-16-34(17-15-33)26(37)20-4-6-21(28)7-5-20/h2-13H,14-18H2,1H3,(H,29,36) |
| InChIKey | XQZJHKMAJFGJPI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|