C28H29N7O3S — CID 4036603
N-[4-[4-(3-methoxybenzoyl)piperazin-1-yl]phenyl]-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 4036603) has the molecular formula C28H29N7O3S and a molecular weight of 543.65 g/mol. Its IUPAC name is N-[4-[4-(3-methoxybenzoyl)piperazin-1-yl]phenyl]-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[4-[4-(3-methoxybenzoyl)piperazin-1-yl]phenyl]-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4036603 |
| Molecular Formula | C28H29N7O3S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | N-[4-[4-(3-methoxybenzoyl)piperazin-1-yl]phenyl]-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | COc1cccc(C(=O)N2CCN(c3ccc(NC(=O)CSc4nnnn4-c4ccccc4C)cc3)CC2)c1 |
| InChI | InChI=1S/C28H29N7O3S/c1-20-6-3-4-9-25(20)35-28(30-31-32-35)39-19-26(36)29-22-10-12-23(13-11-22)33-14-16-34(17-15-33)27(37)21-7-5-8-24(18-21)38-2/h3-13,18H,14-17,19H2,1-2H3,(H,29,36) |
| InChIKey | YWCUDARWVDODAY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|