C29H27ClN4O3S2 — CID 4012973
2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[4-[4-(3-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 4012973) has the molecular formula C29H27ClN4O3S2 and a molecular weight of 579.15 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[4-[4-(3-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[4-[4-(3-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 4012973 |
| Molecular Formula | C29H27ClN4O3S2 |
| Molecular Weight | 579.15 g/mol |
| Exact Mass | 578.12 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[4-[4-(3-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | COc1cccc(C(=O)N2CCN(c3ccc(NC(=O)CSc4nc(-c5ccc(Cl)cc5)cs4)cc3)CC2)c1 |
| InChI | InChI=1S/C29H27ClN4O3S2/c1-37-25-4-2-3-21(17-25)28(36)34-15-13-33(14-16-34)24-11-9-23(10-12-24)31-27(35)19-39-29-32-26(18-38-29)20-5-7-22(30)8-6-20/h2-12,17-18H,13-16,19H2,1H3,(H,31,35) |
| InChIKey | FTAIMPRPZWRWSA-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.15 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|