C22H22ClN3OS2 — CID 3911025
2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 3911025) has the molecular formula C22H22ClN3OS2 and a molecular weight of 444.03 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 3911025 |
| Molecular Formula | C22H22ClN3OS2 |
| Molecular Weight | 444.03 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(CSc1nc(-c2ccc(Cl)cc2)cs1)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H22ClN3OS2/c23-17-6-4-16(5-7-17)20-14-28-22(25-20)29-15-21(27)24-18-8-10-19(11-9-18)26-12-2-1-3-13-26/h4-11,14H,1-3,12-13,15H2,(H,24,27) |
| InChIKey | HVISZVLBKFPXGC-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.03 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|