C29H27ClN4O2S2 — CID 4588545
N-[4-[4-(2-chlorobenzoyl)piperazin-1-yl]phenyl]-2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide (PubChem CID 4588545) has the molecular formula C29H27ClN4O2S2 and a molecular weight of 563.15 g/mol. Its IUPAC name is N-[4-[4-(2-chlorobenzoyl)piperazin-1-yl]phenyl]-2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[4-[4-(2-chlorobenzoyl)piperazin-1-yl]phenyl]-2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4588545 |
| Molecular Formula | C29H27ClN4O2S2 |
| Molecular Weight | 563.15 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | N-[4-[4-(2-chlorobenzoyl)piperazin-1-yl]phenyl]-2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(-c2csc(SCC(=O)Nc3ccc(N4CCN(C(=O)c5ccccc5Cl)CC4)cc3)n2)cc1 |
| InChI | InChI=1S/C29H27ClN4O2S2/c1-20-6-8-21(9-7-20)26-18-37-29(32-26)38-19-27(35)31-22-10-12-23(13-11-22)33-14-16-34(17-15-33)28(36)24-4-2-3-5-25(24)30/h2-13,18H,14-17,19H2,1H3,(H,31,35) |
| InChIKey | IQHRGCZMJMLHOY-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.15 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|