C26H29ClN4O2S2 — CID 3963869
2-[(4-tert-butyl-1,3-thiazol-2-yl)sulfanyl]-N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 3963869) has the molecular formula C26H29ClN4O2S2 and a molecular weight of 529.13 g/mol. Its IUPAC name is 2-[(4-tert-butyl-1,3-thiazol-2-yl)sulfanyl]-N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-[(4-tert-butyl-1,3-thiazol-2-yl)sulfanyl]-N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 3963869 |
| Molecular Formula | C26H29ClN4O2S2 |
| Molecular Weight | 529.13 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 2-[(4-tert-butyl-1,3-thiazol-2-yl)sulfanyl]-N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | CC(C)(C)c1csc(SCC(=O)Nc2ccc(N3CCN(C(=O)c4ccc(Cl)cc4)CC3)cc2)n1 |
| InChI | InChI=1S/C26H29ClN4O2S2/c1-26(2,3)22-16-34-25(29-22)35-17-23(32)28-20-8-10-21(11-9-20)30-12-14-31(15-13-30)24(33)18-4-6-19(27)7-5-18/h4-11,16H,12-15,17H2,1-3H3,(H,28,32) |
| InChIKey | MWJHWSIFMCFURQ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.13 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|