C25H23Cl2N3O2S — CID 2963777
N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2-(4-chlorophenyl)sulfanylacetamide (PubChem CID 2963777) has the molecular formula C25H23Cl2N3O2S and a molecular weight of 500.45 g/mol. Its IUPAC name is N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2-(4-chlorophenyl)sulfanylacetamide.
| Compound Name | N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2-(4-chlorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 2963777 |
| Molecular Formula | C25H23Cl2N3O2S |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2-(4-chlorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)Nc1ccc(N2CCN(C(=O)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H23Cl2N3O2S/c26-19-3-1-18(2-4-19)25(32)30-15-13-29(14-16-30)22-9-7-21(8-10-22)28-24(31)17-33-23-11-5-20(27)6-12-23/h1-12H,13-17H2,(H,28,31) |
| InChIKey | DXLMYQCIEIQCPE-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|