C27H26ClN6O2S+ — CID 3647929
N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]acetamide (PubChem CID 3647929) has the molecular formula C27H26ClN6O2S+ and a molecular weight of 534.07 g/mol. Its IUPAC name is N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]acetamide.
| Compound Name | N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 3647929 |
| Molecular Formula | C27H26ClN6O2S+ |
| Molecular Weight | 534.07 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nc[nH][n+]1-c1ccccc1)Nc1ccc(N2CCN(C(=O)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H25ClN6O2S/c28-21-8-6-20(7-9-21)26(36)33-16-14-32(15-17-33)23-12-10-22(11-13-23)31-25(35)18-37-27-29-19-30-34(27)24-4-2-1-3-5-24/h1-13,19H,14-18H2,(H,31,35)/p+1 |
| InChIKey | IKIACBCIFINNDL-UHFFFAOYSA-O |
| XLogP | 4.03 |
| TPSA | 85.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.07 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|