C18H16FN4O3S+ — CID 4202772
methyl 2-fluoro-5-[[2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]acetyl]amino]benzoate (PubChem CID 4202772) has the molecular formula C18H16FN4O3S+ and a molecular weight of 387.42 g/mol. Its IUPAC name is methyl 2-fluoro-5-[[2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]acetyl]amino]benzoate.
| Compound Name | methyl 2-fluoro-5-[[2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 4202772 |
| Molecular Formula | C18H16FN4O3S+ |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | methyl 2-fluoro-5-[[2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)CSc2nc[nH][n+]2-c2ccccc2)ccc1F |
| InChI | InChI=1S/C18H15FN4O3S/c1-26-17(25)14-9-12(7-8-15(14)19)22-16(24)10-27-18-20-11-21-23(18)13-5-3-2-4-6-13/h2-9,11H,10H2,1H3,(H,22,24)/p+1 |
| InChIKey | QQLBPUVYSRUDBR-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|