C13H16FNO4 — CID 112686654
methyl 2-fluoro-5-[(2-propan-2-yloxyacetyl)amino]benzoate (PubChem CID 112686654) has the molecular formula C13H16FNO4 and a molecular weight of 269.27 g/mol. Its IUPAC name is methyl 2-fluoro-5-[(2-propan-2-yloxyacetyl)amino]benzoate.
| Compound Name | methyl 2-fluoro-5-[(2-propan-2-yloxyacetyl)amino]benzoate |
|---|---|
| PubChem CID | 112686654 |
| Molecular Formula | C13H16FNO4 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | methyl 2-fluoro-5-[(2-propan-2-yloxyacetyl)amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)COC(C)C)ccc1F |
| InChI | InChI=1S/C13H16FNO4/c1-8(2)19-7-12(16)15-9-4-5-11(14)10(6-9)13(17)18-3/h4-6,8H,7H2,1-3H3,(H,15,16) |
| InChIKey | YSTGTOLDNDTDRB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |