C14H16FNO5 — CID 34505734
methyl 5-[(4-ethoxy-4-oxobutanoyl)amino]-2-fluorobenzoate (PubChem CID 34505734) has the molecular formula C14H16FNO5 and a molecular weight of 297.28 g/mol. Its IUPAC name is methyl 5-[(4-ethoxy-4-oxobutanoyl)amino]-2-fluorobenzoate.
| Compound Name | methyl 5-[(4-ethoxy-4-oxobutanoyl)amino]-2-fluorobenzoate |
|---|---|
| PubChem CID | 34505734 |
| Molecular Formula | C14H16FNO5 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | methyl 5-[(4-ethoxy-4-oxobutanoyl)amino]-2-fluorobenzoate |
| SMILES | CCOC(=O)CCC(=O)Nc1ccc(F)c(C(=O)OC)c1 |
| InChI | InChI=1S/C14H16FNO5/c1-3-21-13(18)7-6-12(17)16-9-4-5-11(15)10(8-9)14(19)20-2/h4-5,8H,3,6-7H2,1-2H3,(H,16,17) |
| InChIKey | UJACRRSTVVAECI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |