C15H13FN2O3S — CID 3691695
methyl 2-fluoro-5-[(2-pyridin-2-ylsulfanylacetyl)amino]benzoate (PubChem CID 3691695) has the molecular formula C15H13FN2O3S and a molecular weight of 320.34 g/mol. Its IUPAC name is methyl 2-fluoro-5-[(2-pyridin-2-ylsulfanylacetyl)amino]benzoate.
| Compound Name | methyl 2-fluoro-5-[(2-pyridin-2-ylsulfanylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 3691695 |
| Molecular Formula | C15H13FN2O3S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | methyl 2-fluoro-5-[(2-pyridin-2-ylsulfanylacetyl)amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)CSc2ccccn2)ccc1F |
| InChI | InChI=1S/C15H13FN2O3S/c1-21-15(20)11-8-10(5-6-12(11)16)18-13(19)9-22-14-4-2-3-7-17-14/h2-8H,9H2,1H3,(H,18,19) |
| InChIKey | PGIPTZQGWQSDGJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |