C20H22N5OS+ — CID 3990950
2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 3990950) has the molecular formula C20H22N5OS+ and a molecular weight of 380.50 g/mol. Its IUPAC name is 2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 3990950 |
| Molecular Formula | C20H22N5OS+ |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-[(2-phenyl-1H-1,2,4-triazol-2-ium-3-yl)sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | O=C(CSc1nc[nH][n+]1-c1ccccc1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C20H21N5OS/c26-19(23-16-8-10-17(11-9-16)24-12-4-5-13-24)14-27-20-21-15-22-25(20)18-6-2-1-3-7-18/h1-3,6-11,15H,4-5,12-14H2,(H,23,26)/p+1 |
| InChIKey | ZLINAXNYJQLLTD-UHFFFAOYSA-O |
| XLogP | 3.02 |
| TPSA | 64.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|